| Verifiedrevid | 443461881 |
|---|---|
| Iupac name | (1S,5S)-3-dibenzo[b,e]thiepin-11(6H)-ylidene-8-methyl-8-azabicyclo[3.2.1]octane |
| Tradename | Lepticur |
| Cas number | 27574-24-9 |
| Atc prefix | N04 |
| Atc suffix | AA12 |
| Pubchem | 198068 |
| Chemspiderid | 171431 |
| Unii | C27HY5RFU5 |
| Kegg | D07303 |
| C | 22 |
| H | 23 |
| N | 1 |
| S | 1 |
| Smiles | S3c1ccccc1/C(c2c(cccc2)C3)=C5/CC4N(C)C(CC4)C5 |
| Stdinchi | 1S/C22H23NS/c1-23-17-10-11-18(23)13-16(12-17)22-19-7-3-2-6-15(19)14-24-21-9-5-4-8-20(21)22/h2-9,17-18H,10-14H2,1H3 |
| Stdinchikey | JOQKFRLFXDPXHX-UHFFFAOYSA-N |
Tropatepine (brand name Lepticur) is an anticholinergic used as an antiparkinsonian agent.[1]
Synthesis
Tropatepine can be synthesized from 3-chlorotropane (1).[2] A Grignard reaction between 3-chlorotropane and dibenzo[b,e]thiepin-11(6H)-one (2) followed by dehydration to the olefin produces tropatepine (3).
See also
References
- ^ Celsis P, Montastruc JL, Rascol O, Senard JM, Marc-Vergnes JP, Rascol A (July 1989). "Effect of tropatepine, an anticholinergic drug, on regional cerebral blood flow in patients with Parkinson's disease". Journal of Neurology, Neurosurgery, and Psychiatry. 52 (7): 917–8. doi:10.1136/jnnp.52.7.917. PMC 1031949. PMID 2769291
- ^ DE1952206 idem J Boissier, R Ratouis, (1973 to Ind Pour La Fab Antibiotiques).