| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 470617213 |
| Iupac name | 2-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-yl- prop-1-enyl]pyridine |
| Tradename | Flonase Nighttime Allergy Relief, Actidil, others |
| Pregnancy category | C (US) |
| Legal us | otc |
| Routes of administration | By mouth |
| Bioavailability | Oral: 4% |
| Protein bound | 90% |
| Metabolism | Hepatic (CYP2D6) |
| Elimination half-life | 4–6 hours |
| Excretion | Renal |
| Cas number | 486-12-4 |
| Atc prefix | R06 |
| Atc suffix | AX07 |
| Pubchem | 5282443 |
| Iuphar ligand | 1228 |
| Drugbank | DB00427 |
| Chemspiderid | 4445597 |
| Unii | 2L8T9S52QM |
| Kegg | D01782 |
| Chebi | 84116 |
| Chembl | 855 |
| C | 19 |
| H | 22 |
| N | 2 |
| Smiles | n3c(\C(=C\CN1CCCC1)c2ccc(cc2)C)cccc3 |
| Stdinchi | 1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+ |
| Stdinchikey | CBEQULMOCCWAQT-WOJGMQOQSA-N |
| Melting point | 60 |
| Solubility | 500 |
Triprolidine is an over-the-counter first-generation antihistamine with strong anticholinergic properties.[1] It is used to combat the symptoms associated with allergies and is sometimes combined with other medications in preparations designed to provide general relief for flu-like symptoms.[2] As with many antihistamines, the most common side effect is drowsiness.[1]
Triprolidine was patented in 1948 and came into medical use in 1953,[3] and has mostly been replaced in popular cold and flu medications by other drugs such as diphenhydramine, promethazine, chlorpheniramine, loratadine and fexofenadine.
See also
References
- ^ Goldsmith P, Dowd PM (January 1993). "The new H1 antihistamines. Treatment of urticaria and other clinical problems". Dermatologic Clinics. 11 (1): 87–95. doi:10.1016/S0733-8635(18)30285-7. PMID 8094649
- ^ Williams BO, Liao SH, Lai AA, Arnold JD, Perkins JG, Blum MR, Findlay JW (1984). "Bioavailability of pseudoephedrine and triprolidine from combination and single-ingredient products". Clinical Pharmacy. 3 (6): 638–43. PMID 6509877
- ^ Fischer J, Ganellin CR (2006). Analogue-based Drug Discovery. John Wiley & Sons. p. 546. ISBN 9783527607495.