| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 448209127 |
| Iupac name | 2,3,5-tris(aziridin-1-yl)benzo-1,4-quinone |
| Cas number | 68-76-8 |
| Atc prefix | L01 |
| Atc suffix | AC02 |
| Pubchem | 6235 |
| Unii | F3D5D9P25I |
| Chebi | 27090 |
| Kegg | C19542 |
| Chemspiderid | 5999 |
| C | 12 |
| H | 13 |
| N | 3 |
| O | 2 |
| Synonyms |
|
| Smiles | C1CN1C2=CC(=O)C(=C(C2=O)N3CC3)N4CC4 |
| Stdinchi | 1S/C12H13N3O2/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14/h7H,1-6H2 |
| Stdinchikey | PXSOHRWMIRDKMP-UHFFFAOYSA-N |
Triaziquone is a drug used in chemotherapy.
It is aziridinylbenzoquinone-based, and may have potential antineoplastic activity. [1]
It is an alkylating agent. It can react with DNA to form intrastrand crosslinks. It is a member of aziridines as well. [2]
References
- ^ PubChem. "Triaziquone". pubchem.ncbi.nlm.nih.gov. Retrieved 2023-10-10.
- ^ Huang CH, Kuo HS, Liu JW, Lin YL (June 2009). "Synthesis and antitumor evaluation of novel bis-triaziquone derivatives". Molecules (Basel, Switzerland). 14 (7): 2306–16. doi:10.3390/molecules14072306. PMC 6255275. PMID 19633605