| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 384087896 |
| Iupac name | 5-Ethyl-8-oxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinoline- 7-carboxylic acid |
| Cas number | 14698-29-4 |
| Atc prefix | J01 |
| Atc suffix | MB05 |
| Pubchem | 4628 |
| Unii | L0A22B22FT |
| Kegg | D02301 |
| Chembl | 416755 |
| Chebi | 138856 |
| Chemspiderid | 4467 |
| C | 13 |
| H | 11 |
| N | 1 |
| O | 5 |
| Smiles | CCN1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O |
| Stdinchi | 1S/C13H11NO5/c1-2-14-5-8(13(16)17)12(15)7-3-10-11(4-9(7)14)19-6-18-10/h3-5H,2,6H2,1H3,(H,16,17) |
| Stdinchikey | KYGZCKSPAKDVKC-UHFFFAOYSA-N |
Oxolinic acid is a quinolone antibiotic developed in Japan in the 1970s.[1][2] Dosages 12–20 mg/kg orally administered for five to ten days. The antibiotic works by inhibiting the enzyme DNA gyrase. It also acts as a dopamine reuptake inhibitor and has stimulant effects in mice.[3]
See also
References
- ^ JP Patent 49138244
- ^ Gleckman R, Alvarez S, Joubert DW, Matthews SJ (August 1979). "Drug therapy reviews: oxolinic acid". American Journal of Hospital Pharmacy. 36 (8): 1077–9. PMID 384788
- ^ Garcia de Mateos-Verchere J, Vaugeois JM, Naudin B, Costentin J (December 1998). "Behavioural and neurochemical evidence that the antimicrobial agent oxolinic acid is a dopamine uptake inhibitor". European Neuropsychopharmacology. 8 (4): 255–9. doi:10.1016/S0924-977X(97)00083-7. PMID 9928913. S2CID 22626555