| Verifiedrevid | 437134719 |
|---|---|
| Iupac name | 1-(4-Fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one |
| Width | 240 |
| Cas number | 1480-19-9 |
| Atc prefix | N05 |
| Atc suffix | AD09 |
| Pubchem | 15139 |
| Drugbank | DB13665 |
| Chemspiderid | 14410 |
| Unii | 1D0W98U1I4 |
| Kegg | D02621 |
| Chembl | 58792 |
| C | 21 |
| H | 25 |
| F | 1 |
| N | 2 |
| O | 2 |
| Smiles | Fc1ccc(cc1)C(=O)CCCN3CCN(c2ccccc2OC)CC3 |
| Stdinchi | 1S/C21H25FN2O2/c1-26-21-7-3-2-5-19(21)24-15-13-23(14-16-24)12-4-6-20(25)17-8-10-18(22)11-9-17/h2-3,5,7-11H,4,6,12-16H2,1H3 |
| Stdinchikey | IRYFCWPNDIUQOW-UHFFFAOYSA-N |
Fluanisone is a typical antipsychotic and sedative of the butyrophenone chemical class.[1] It is used in the treatment of schizophrenia and mania. It is also a component (along with fentanyl) of the injectable veterinary formulation fentanyl/fluanisone (Hypnorm)[2] where it is used for rodent analgesia during short surgical procedures.
See also
References
- ^ Janssen PA (1967). "Haloperidol and related butyrophenones". Psychopharmacological agents.. Vol. 2. Medicinal Chemistry. New York: Academic Press. pp. 199–248 (227). ISBN 978-1-4832-7446-1.
- ^ "Fluanisone". drugs.com