| Iupac name | [(8R,9S,13S,14S,16R,17R)-13-methyl-3,17-di(propanoyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl] propanoate |
|---|---|
| Width | 250px |
| Tradename | Estriel |
| Routes of administration | Intramuscular injection |
| Class | Estrogen; Estrogen ester |
| Cas number | 2236-31-9 |
| Pubchem | 102232 |
| Drugbank | DB14641 |
| Chemspiderid | 92362 |
| Unii | S2A0P1AFQ9 |
| Synonyms | Oestriol tripropionate; Estriol tripropanoate |
| C | 27 |
| H | 36 |
| O | 6 |
| Smiles | CCC(=O)O[C@@H]1C[C@H]2[C@@H]3CCc4cc(OC(=O)CC)ccc4[C@H]3CC[C@]2(C)[C@H]1OC(=O)CC |
| Stdinchi | 1S/C27H36O6/c1-5-23(28)31-17-9-11-18-16(14-17)8-10-20-19(18)12-13-27(4)21(20)15-22(32-24(29)6-2)26(27)33-25(30)7-3/h9,11,14,19-22,26H,5-8,10,12-13,15H2,1-4H3/t19-,20-,21+,22-,26+,27+/m1/s1 |
| Stdinchikey | ONMZMZJEZHMWQL-REUUDLSRSA-N |
Estriol tripropionate (brand name Estriel), or estriol tripropanoate, is an estrogen medication.[1] It is an estrogen ester, specifically, an ester of estriol.[1]
See also
References
- ^ Elks J (14 November 2014). The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies. Springer. p. 899. ISBN 978-1-4757-2085-3.