| Verifiedrevid | 447613606 |
|---|---|
| Iupac name | N-[2-(Diethylamino)ethyl]-N-propylnaphthalene-1-carboxamide |
| Cas number | 32421-46-8 |
| Atc prefix | C01 |
| Atc suffix | BD03 |
| Pubchem | 36131 |
| Chembl | 2104200 |
| Chemspiderid | 33233 |
| Unii | GH09PRQ3FU |
| Kegg | D07428 |
| C | 21 |
| H | 30 |
| N | 2 |
| O | 1 |
| Smiles | O=C(N(CCCC)CCN(CC)CC)c2cccc1ccccc12 |
| Stdinchi | 1S/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20/h8-14H,4-7,15-17H2,1-3H3 |
| Stdinchikey | WWGZXRYELYWJBD-UHFFFAOYSA-N |
Bunaftine (or bunaphtine[1]) is an antiarrhythmic agent.[2] It is classified in class III.[3]
References
- ^ Tamargo J (August 1980). "Electrophysiological effects of bunaphtine in guinea-pig ventricular fibers". Arch Int Pharmacodyn Ther. 246 (2): 224–36. PMID 7436628
- ^ Ferro G, Chiariello M, Tari MG, Vigorito C, Ungaro B, Condorelli M (May 1983). "Intropic effects of several antiarrhythmic drugs". Jpn Heart J. 24 (3): 377–90. doi:10.1536/ihj.24.377. PMID 6876382
- ^ Fenici R, Marchei M, Bellocci F, Zecchi P (July 1977). "Effect of bunaphtine on right atrial repolarisation in man". Br Heart J. 39 (7): 787–94. doi:10.1136/hrt.39.7.787. PMC 483317. PMID 328029