| Verifiedrevid | 459715971 |
|---|---|
| Iupac name | 2-[(1-{2-[2-(2-{2-[2-(2-amino-3-carbamoylpropanamido)-5-[(diaminomethylidene)amino]pentanamido]-3-methylbutanamido}-3-(4-hydroxyphenyl)propanamido)-3-methylbutanamido]-3-(1H-imidazol-5-yl)propanoyl}pyrrolidin-2-yl)formamido]-3-phenylpropanoic acid |
| Routes of administration | Intravenous infusion |
| Cas number | 53-73-6 |
| Atc prefix | C01 |
| Atc suffix | CX06 |
| Unii | 7WAL1X78KV |
| Kegg | D02939 |
| Chembl | 409803 |
| Pubchem | 10351092 |
| Chemspiderid | 8526544 |
| Smiles | O=C(N)C[C@H](N)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)O)Cc1ccccc1)CCC2)Cc3cnc[nH]3)C(C)C)Cc4ccc(O)cc4)C(C)C)CCC/N=C(\N)N |
| Stdinchi | 1S/C49H70N14O11/c1-26(2)39(61-42(67)33(12-8-18-55-49(52)53)57-41(66)32(50)23-38(51)65)45(70)58-34(20-29-14-16-31(64)17-15-29)43(68)62-40(27(3)4)46(71)59-35(22-30-24-54-25-56-30)47(72)63-19-9-13-37(63)44(69)60-36(48(73)74)21-28-10-6-5-7-11-28/h5-7,10-11,14-17,24-27,32-37,39-40,64H,8-9,12-13,18-23,50H2,1-4H3,(H2,51,65)(H,54,56)(H,57,66)(H,58,70)(H,59,71)(H,60,69)(H,61,67)(H,62,68)(H,73,74)(H4,52,53,55)/t32-,33-,34-,35-,36-,37-,39-,40-/m0/s1 |
| Stdinchikey | JYPVVOOBQVVUQV-CGHBYZBKSA-N |
| C | 49 |
| H | 70 |
| N | 14 |
| O | 11 |
Angiotensinamide (INN; BAN and USAN angiotensin amide) is a potent vasoconstrictor used as a cardiac stimulant.[1] It is a derivative of angiotensin II.[2]
See also
References
- ^ Paiva TB, Paiva AC (December 1960). "Some pharmacological actions of synthetic analogues of angiotensinamide". British Journal of Pharmacology and Chemotherapy. 15 (4): 557–560. doi:10.1111/j.1476-5381.1960.tb00281.x. PMC 1482268. PMID 13732133
- ^ "Angiotensinamide". Index nominum, international drug directory = internationales Arzneistoff-und Arzneimittelverzeichnis = répertoire international des substances médicamenteuses et spécialités pharmaceutiques. 17th ed. Stuttgart: Medpharm Scientific Publishers. 2000. p. 64. ISBN 978-3-88763-075-1.